C20H24N2OS — CID 119935530
N-(1,2-diphenylethyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119935530) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(1,2-diphenylethyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119935530 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-(1,2-diphenylethyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2OS/c23-20(14-18-15-24-12-11-21-18)22-19(17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1-10,18-19,21H,11-15H2,(H,22,23) |
| InChIKey | QLWGSJRTDVVPHG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |