C17H25ClN2O2S — CID 119938079
N-[oxolan-2-yl(phenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119938079) has the molecular formula C17H25ClN2O2S and a molecular weight of 356.92 g/mol. Its IUPAC name is N-[oxolan-2-yl(phenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[oxolan-2-yl(phenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119938079 |
| Molecular Formula | C17H25ClN2O2S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[oxolan-2-yl(phenyl)methyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CSCCN1)NC(c1ccccc1)C1CCCO1 |
| InChI | InChI=1S/C17H24N2O2S.ClH/c20-16(11-14-12-22-10-8-18-14)19-17(15-7-4-9-21-15)13-5-2-1-3-6-13;/h1-3,5-6,14-15,17-18H,4,7-12H2,(H,19,20);1H |
| InChIKey | NIWRADXHDFDGPC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |