C17H23NO4 — CID 124625518
2-(1,3-dioxan-2-yl)-N-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]acetamide (PubChem CID 124625518) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(1,3-dioxan-2-yl)-N-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]acetamide.
| Compound Name | 2-(1,3-dioxan-2-yl)-N-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 124625518 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(1,3-dioxan-2-yl)-N-[(S)-[(2S)-oxolan-2-yl]-phenylmethyl]acetamide |
| SMILES | O=C(CC1OCCCO1)N[C@@H](c1ccccc1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H23NO4/c19-15(12-16-21-10-5-11-22-16)18-17(14-8-4-9-20-14)13-6-2-1-3-7-13/h1-3,6-7,14,16-17H,4-5,8-12H2,(H,18,19)/t14-,17-/m0/s1 |
| InChIKey | GKEZLPSJXGIKTC-YOEHRIQHSA-N |
| XLogP | 2.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |