C19H21ClN2OS — CID 119937245
N-[(3-chlorophenyl)-phenylmethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119937245) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-phenylmethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[(3-chlorophenyl)-phenylmethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119937245 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[(3-chlorophenyl)-phenylmethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NC(c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2OS/c20-16-8-4-7-15(11-16)19(14-5-2-1-3-6-14)22-18(23)12-17-13-24-10-9-21-17/h1-8,11,17,19,21H,9-10,12-13H2,(H,22,23) |
| InChIKey | JCKFFEYLFYGCPS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |