C14H20ClN3O3S2 — CID 119936053
N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119936053) has the molecular formula C14H20ClN3O3S2 and a molecular weight of 377.92 g/mol. Its IUPAC name is N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119936053 |
| Molecular Formula | C14H20ClN3O3S2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H20ClN3O3S2/c15-11-2-1-3-13(8-11)23(20,21)18-5-4-17-14(19)9-12-10-22-7-6-16-12/h1-3,8,12,16,18H,4-7,9-10H2,(H,17,19) |
| InChIKey | DSQHFPIREPYAIC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|