C14H20N4O5S2 — CID 119939474
N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119939474) has the molecular formula C14H20N4O5S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119939474 |
| Molecular Formula | C14H20N4O5S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O5S2/c19-14(9-11-10-24-8-7-15-11)16-5-6-17-25(22,23)13-4-2-1-3-12(13)18(20)21/h1-4,11,15,17H,5-10H2,(H,16,19) |
| InChIKey | UOXRODCMOPDMBA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|