C15H21FN2OS2 — CID 119935568
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119935568) has the molecular formula C15H21FN2OS2 and a molecular weight of 328.48 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119935568 |
| Molecular Formula | C15H21FN2OS2 |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)NCCSCc1ccccc1F |
| InChI | InChI=1S/C15H21FN2OS2/c16-14-4-2-1-3-12(14)10-20-8-6-18-15(19)9-13-11-21-7-5-17-13/h1-4,13,17H,5-11H2,(H,18,19) |
| InChIKey | OGBZOKLUSLTHNJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|