C14H19FN2OS — CID 66422615
N-[(2-fluorophenyl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide (PubChem CID 66422615) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66422615 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide |
| SMILES | CN(Cc1ccccc1F)C(=O)CC1CSCCN1 |
| InChI | InChI=1S/C14H19FN2OS/c1-17(9-11-4-2-3-5-13(11)15)14(18)8-12-10-19-7-6-16-12/h2-5,12,16H,6-10H2,1H3 |
| InChIKey | WHOGPBDEFGTOKQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |