C12H17ClN2OS2 — CID 66422444
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide (PubChem CID 66422444) has the molecular formula C12H17ClN2OS2 and a molecular weight of 304.87 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66422444 |
| Molecular Formula | C12H17ClN2OS2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-2-thiomorpholin-3-ylacetamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)CC1CSCCN1 |
| InChI | InChI=1S/C12H17ClN2OS2/c1-15(7-10-2-3-11(13)18-10)12(16)6-9-8-17-5-4-14-9/h2-3,9,14H,4-8H2,1H3 |
| InChIKey | YHIKRONGGJGTFA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |