C10H20N2O2S2 — CID 115746776
N-(2-ethylsulfinylethyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 115746776) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is N-(2-ethylsulfinylethyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(2-ethylsulfinylethyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 115746776 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-(2-ethylsulfinylethyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | CCS(=O)CCNC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C10H20N2O2S2/c1-2-16(14)6-4-12-10(13)7-9-8-15-5-3-11-9/h9,11H,2-8H2,1H3,(H,12,13) |
| InChIKey | VDQZQHSKFJJCJH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |