C24H40N4O2S — CID 98111295
1-(1-adamantyl)-3-[(1S,5S)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea (PubChem CID 98111295) has the molecular formula C24H40N4O2S and a molecular weight of 448.68 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(1S,5S)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(1S,5S)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
|---|---|
| PubChem CID | 98111295 |
| Molecular Formula | C24H40N4O2S |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 1-(1-adamantyl)-3-[(1S,5S)-8-(3-ethoxypropylcarbamothioyl)-8-azabicyclo[3.2.1]octan-3-yl]urea |
| SMILES | CCOCCCNC(=S)N1[C@H]2CC[C@H]1CC(NC(=O)NC13CC4CC(CC(C4)C1)C3)C2 |
| InChI | InChI=1S/C24H40N4O2S/c1-2-30-7-3-6-25-23(31)28-20-4-5-21(28)12-19(11-20)26-22(29)27-24-13-16-8-17(14-24)10-18(9-16)15-24/h16-21H,2-15H2,1H3,(H,25,31)(H2,26,27,29)/t16?,17?,18?,20-,21-,24?/m0/s1 |
| InChIKey | WUWHNPFRCNXHHX-BOSZTNLGSA-N |
| XLogP | 3.55 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|