C26H36N4O2S — CID 25414870
1-(1-adamantyl)-3-[(1R,5S)-8-[(2-methoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea (PubChem CID 25414870) has the molecular formula C26H36N4O2S and a molecular weight of 468.67 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(1R,5S)-8-[(2-methoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(1R,5S)-8-[(2-methoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea |
|---|---|
| PubChem CID | 25414870 |
| Molecular Formula | C26H36N4O2S |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-(1-adamantyl)-3-[(1R,5S)-8-[(2-methoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea |
| SMILES | COc1ccccc1NC(=S)N1[C@@H]2CC[C@H]1CC(NC(=O)NC13CC4CC(CC(C4)C1)C3)C2 |
| InChI | InChI=1S/C26H36N4O2S/c1-32-23-5-3-2-4-22(23)28-25(33)30-20-6-7-21(30)12-19(11-20)27-24(31)29-26-13-16-8-17(14-26)10-18(9-16)15-26/h2-5,16-21H,6-15H2,1H3,(H,28,33)(H2,27,29,31)/t16?,17?,18?,19?,20-,21+,26? |
| InChIKey | PODYNAKGCGXXAH-BKQVXRIPSA-N |
| XLogP | 4.66 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|