C27H38N4O3S — CID 98111320
1-(1-adamantyl)-3-[(1S,5S)-8-[(2,4-dimethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea (PubChem CID 98111320) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(1S,5S)-8-[(2,4-dimethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(1S,5S)-8-[(2,4-dimethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea |
|---|---|
| PubChem CID | 98111320 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1-(1-adamantyl)-3-[(1S,5S)-8-[(2,4-dimethoxyphenyl)carbamothioyl]-8-azabicyclo[3.2.1]octan-3-yl]urea |
| SMILES | COc1ccc(NC(=S)N2[C@H]3CC[C@H]2CC(NC(=O)NC24CC5CC(CC(C5)C2)C4)C3)c(OC)c1 |
| InChI | InChI=1S/C27H38N4O3S/c1-33-22-5-6-23(24(12-22)34-2)29-26(35)31-20-3-4-21(31)11-19(10-20)28-25(32)30-27-13-16-7-17(14-27)9-18(8-16)15-27/h5-6,12,16-21H,3-4,7-11,13-15H2,1-2H3,(H,29,35)(H2,28,30,32)/t16?,17?,18?,20-,21-,27?/m0/s1 |
| InChIKey | FIYOFOWNRAVWGF-AZAQSJQWSA-N |
| XLogP | 4.66 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|