C20H29N2O3+ — CID 7666342
1-adamantyl-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium (PubChem CID 7666342) has the molecular formula C20H29N2O3+ and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-adamantyl-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium.
| Compound Name | 1-adamantyl-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7666342 |
| Molecular Formula | C20H29N2O3+ |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-adamantyl-[2-(2,4-dimethoxyanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc(NC(=O)C[NH2+]C23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C20H28N2O3/c1-24-16-3-4-17(18(8-16)25-2)22-19(23)12-21-20-9-13-5-14(10-20)7-15(6-13)11-20/h3-4,8,13-15,21H,5-7,9-12H2,1-2H3,(H,22,23)/p+1 |
| InChIKey | YKYHRIFLYYINJZ-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |