C15H19N2O3S+ — CID 7406588
[2-(2,4-dimethoxyanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 7406588) has the molecular formula C15H19N2O3S+ and a molecular weight of 307.40 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7406588 |
| Molecular Formula | C15H19N2O3S+ |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | COc1ccc(NC(=O)C[NH2+]Cc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-19-11-5-6-13(14(8-11)20-2)17-15(18)10-16-9-12-4-3-7-21-12/h3-8,16H,9-10H2,1-2H3,(H,17,18)/p+1 |
| InChIKey | SIWBNLMEWQTAPI-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |