C17H19NO5S — CID 8529441
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate (PubChem CID 8529441) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 8529441 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C17H19NO5S/c1-21-12-5-7-14(15(10-12)22-2)18-16(19)11-23-17(20)8-6-13-4-3-9-24-13/h3-5,7,9-10H,6,8,11H2,1-2H3,(H,18,19) |
| InChIKey | XTERSAQJKLLRIB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |