C15H13F2NO3S — CID 8529533
[2-(2,5-difluoroanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate (PubChem CID 8529533) has the molecular formula C15H13F2NO3S and a molecular weight of 325.34 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 8529533 |
| Molecular Formula | C15H13F2NO3S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate |
| SMILES | O=C(COC(=O)CCc1cccs1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C15H13F2NO3S/c16-10-3-5-12(17)13(8-10)18-14(19)9-21-15(20)6-4-11-2-1-7-22-11/h1-3,5,7-8H,4,6,9H2,(H,18,19) |
| InChIKey | CLSLPTNTRMSFHV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |