C17H16N2O3S2 — CID 8532178
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-thiophen-2-ylpropanoate (PubChem CID 8532178) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-thiophen-2-ylpropanoate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 8532178 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-thiophen-2-ylpropanoate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)CCc1cccs1 |
| InChI | InChI=1S/C17H16N2O3S2/c18-9-11-24-15-6-2-1-5-14(15)19-16(20)12-22-17(21)8-7-13-4-3-10-23-13/h1-6,10H,7-8,11-12H2,(H,19,20) |
| InChIKey | ASGHLMHJZLGQRO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |