C18H18N2O3S2 — CID 8532079
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate (PubChem CID 8532079) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 8532079 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 3-thiophen-2-ylpropanoate |
| SMILES | Cc1cc(SC#N)cc(C)c1NC(=O)COC(=O)CCc1cccs1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-12-8-15(25-11-19)9-13(2)18(12)20-16(21)10-23-17(22)6-5-14-4-3-7-24-14/h3-4,7-9H,5-6,10H2,1-2H3,(H,20,21) |
| InChIKey | YLDKUYFZLRTQLZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|