C22H18N2O3S — CID 7980728
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 7980728) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7980728 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | Cc1cc(SC#N)cc(C)c1NC(=O)COC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H18N2O3S/c1-14-9-19(28-13-23)10-15(2)21(14)24-20(25)12-27-22(26)18-8-7-16-5-3-4-6-17(16)11-18/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | YBSGAQHNTHANRS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|