C18H17N3O3S2 — CID 8765438
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 8765438) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8765438 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CSc1ncccc1C(=O)OCC(=O)Nc1c(C)cc(SC#N)cc1C |
| InChI | InChI=1S/C18H17N3O3S2/c1-11-7-13(26-10-19)8-12(2)16(11)21-15(22)9-24-18(23)14-5-4-6-20-17(14)25-3/h4-8H,9H2,1-3H3,(H,21,22) |
| InChIKey | NMIZHXJWQJTSEE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|