C16H20N2O3S — CID 7790460
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] pentanoate (PubChem CID 7790460) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] pentanoate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] pentanoate |
|---|---|
| PubChem CID | 7790460 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] pentanoate |
| SMILES | CCCCC(=O)OCC(=O)Nc1c(C)cc(SC#N)cc1C |
| InChI | InChI=1S/C16H20N2O3S/c1-4-5-6-15(20)21-9-14(19)18-16-11(2)7-13(22-10-17)8-12(16)3/h7-8H,4-6,9H2,1-3H3,(H,18,19) |
| InChIKey | RDFUXSIRWMBPTR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|