C19H17ClN2O4S — CID 7803897
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate (PubChem CID 7803897) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 7803897 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 2-(3-chlorophenoxy)acetate |
| SMILES | Cc1cc(SC#N)cc(C)c1NC(=O)COC(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O4S/c1-12-6-16(27-11-21)7-13(2)19(12)22-17(23)9-26-18(24)10-25-15-5-3-4-14(20)8-15/h3-8H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | UAIMXOXTMQRVTJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|