C19H16N2O5S — CID 8012657
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 8012657) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 8012657 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1cc(SC#N)cc(C)c1NC(=O)COC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16N2O5S/c1-11-5-14(27-9-20)6-12(2)18(11)21-17(22)8-24-19(23)13-3-4-15-16(7-13)26-10-25-15/h3-7H,8,10H2,1-2H3,(H,21,22) |
| InChIKey | NCJXFJLQNHQZHP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|