C21H22N2O4S — CID 7193432
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate (PubChem CID 7193432) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 7193432 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] 4-propan-2-yloxybenzoate |
| SMILES | Cc1cc(SC#N)cc(C)c1NC(=O)COC(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-13(2)27-17-7-5-16(6-8-17)21(25)26-11-19(24)23-20-14(3)9-18(28-12-22)10-15(20)4/h5-10,13H,11H2,1-4H3,(H,23,24) |
| InChIKey | AKNJAQOOKOTJGC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|