C20H17FN2O3S — CID 8021360
[2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 8021360) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8021360 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2-(2,6-dimethyl-4-thiocyanatoanilino)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cc(SC#N)cc(C)c1NC(=O)COC(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C20H17FN2O3S/c1-13-8-17(27-12-22)9-14(2)20(13)23-18(24)11-26-19(25)7-6-15-4-3-5-16(21)10-15/h3-10H,11H2,1-2H3,(H,23,24)/b7-6+ |
| InChIKey | FEJWTEIWHCIXOA-VOTSOKGWSA-N |
| XLogP | 4.21 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|