C16H15F2NO3S — CID 7962789
[2-(3,4-difluoroanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate (PubChem CID 7962789) has the molecular formula C16H15F2NO3S and a molecular weight of 339.36 g/mol. Its IUPAC name is [2-(3,4-difluoroanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate.
| Compound Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7962789 |
| Molecular Formula | C16H15F2NO3S |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [2-(3,4-difluoroanilino)-2-oxoethyl] 4-thiophen-2-ylbutanoate |
| SMILES | O=C(COC(=O)CCCc1cccs1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H15F2NO3S/c17-13-7-6-11(9-14(13)18)19-15(20)10-22-16(21)5-1-3-12-4-2-8-23-12/h2,4,6-9H,1,3,5,10H2,(H,19,20) |
| InChIKey | ABLFVARACPCSQJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |