C18H16F2N2OS2 — CID 8800785
2-[bis(thiophen-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide (PubChem CID 8800785) has the molecular formula C18H16F2N2OS2 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[bis(thiophen-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[bis(thiophen-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 8800785 |
| Molecular Formula | C18H16F2N2OS2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[bis(thiophen-2-ylmethyl)amino]-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(CN(Cc1cccs1)Cc1cccs1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H16F2N2OS2/c19-16-6-5-13(9-17(16)20)21-18(23)12-22(10-14-3-1-7-24-14)11-15-4-2-8-25-15/h1-9H,10-12H2,(H,21,23) |
| InChIKey | XHRDZPBXSNICKG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |