C20H21FN2OS2 — CID 8801393
2-[bis(thiophen-2-ylmethyl)amino]-N-[2-(2-fluorophenyl)ethyl]acetamide (PubChem CID 8801393) has the molecular formula C20H21FN2OS2 and a molecular weight of 388.53 g/mol. Its IUPAC name is 2-[bis(thiophen-2-ylmethyl)amino]-N-[2-(2-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[bis(thiophen-2-ylmethyl)amino]-N-[2-(2-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 8801393 |
| Molecular Formula | C20H21FN2OS2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[bis(thiophen-2-ylmethyl)amino]-N-[2-(2-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(CN(Cc1cccs1)Cc1cccs1)NCCc1ccccc1F |
| InChI | InChI=1S/C20H21FN2OS2/c21-19-8-2-1-5-16(19)9-10-22-20(24)15-23(13-17-6-3-11-25-17)14-18-7-4-12-26-18/h1-8,11-12H,9-10,13-15H2,(H,22,24) |
| InChIKey | BFXNTIIXSJWDHH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |