C19H23FN2O2S — CID 87000019
3-[2-(2-fluorophenyl)ethyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea (PubChem CID 87000019) has the molecular formula C19H23FN2O2S and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)ethyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-[2-(2-fluorophenyl)ethyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 87000019 |
| Molecular Formula | C19H23FN2O2S |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-[2-(2-fluorophenyl)ethyl]-1-(oxolan-2-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCCc1ccccc1F)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C19H23FN2O2S/c20-18-8-2-1-5-15(18)9-10-21-19(23)22(13-16-6-3-11-24-16)14-17-7-4-12-25-17/h1-2,4-5,7-8,12,16H,3,6,9-11,13-14H2,(H,21,23) |
| InChIKey | ZJYILHWMWKBMOR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |