C17H17F2NO2S — CID 60601065
3,4-difluoro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 60601065) has the molecular formula C17H17F2NO2S and a molecular weight of 337.39 g/mol. Its IUPAC name is 3,4-difluoro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3,4-difluoro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60601065 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3,4-difluoro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(F)c(F)c1)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C17H17F2NO2S/c18-15-6-5-12(9-16(15)19)17(21)20(10-13-3-1-7-22-13)11-14-4-2-8-23-14/h2,4-6,8-9,13H,1,3,7,10-11H2 |
| InChIKey | KBTKEXHXACQKIA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |