C23H29ClN2O4S2 — CID 134015179
3-(azepan-1-ylsulfonyl)-4-chloro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 134015179) has the molecular formula C23H29ClN2O4S2 and a molecular weight of 497.08 g/mol. Its IUPAC name is 3-(azepan-1-ylsulfonyl)-4-chloro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 134015179 |
| Molecular Formula | C23H29ClN2O4S2 |
| Molecular Weight | 497.08 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 3-(azepan-1-ylsulfonyl)-4-chloro-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C23H29ClN2O4S2/c24-21-10-9-18(15-22(21)32(28,29)26-11-3-1-2-4-12-26)23(27)25(16-19-7-5-13-30-19)17-20-8-6-14-31-20/h6,8-10,14-15,19H,1-5,7,11-13,16-17H2 |
| InChIKey | LMZMTNNXGPZWEG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |