C17H18INO2S — CID 55389165
3-iodo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 55389165) has the molecular formula C17H18INO2S and a molecular weight of 427.31 g/mol. Its IUPAC name is 3-iodo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-iodo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55389165 |
| Molecular Formula | C17H18INO2S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 3-iodo-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1cccc(I)c1)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C17H18INO2S/c18-14-5-1-4-13(10-14)17(20)19(11-15-6-2-8-21-15)12-16-7-3-9-22-16/h1,3-5,7,9-10,15H,2,6,8,11-12H2 |
| InChIKey | FFLMRQAKNFZFGW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|