C18H18F3NO3S — CID 55389257
N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-4-(trifluoromethoxy)benzamide (PubChem CID 55389257) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 55389257 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(c1ccc(OC(F)(F)F)cc1)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C18H18F3NO3S/c19-18(20,21)25-14-7-5-13(6-8-14)17(23)22(11-15-3-1-9-24-15)12-16-4-2-10-26-16/h2,4-8,10,15H,1,3,9,11-12H2 |
| InChIKey | ARIYRXLGPVWNJR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |