C21H28N2O4S2 — CID 55507704
4-[methyl(propan-2-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 55507704) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-[methyl(propan-2-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-[methyl(propan-2-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55507704 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 4-[methyl(propan-2-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CC(C)N(C)S(=O)(=O)c1ccc(C(=O)N(Cc2cccs2)CC2CCCO2)cc1 |
| InChI | InChI=1S/C21H28N2O4S2/c1-16(2)22(3)29(25,26)20-10-8-17(9-11-20)21(24)23(14-18-6-4-12-27-18)15-19-7-5-13-28-19/h5,7-11,13,16,18H,4,6,12,14-15H2,1-3H3 |
| InChIKey | LIGREMYDUQXFJW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |