C17H18NO5S2- — CID 6971383
4-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate (PubChem CID 6971383) has the molecular formula C17H18NO5S2- and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate.
| Compound Name | 4-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 6971383 |
| Molecular Formula | C17H18NO5S2- |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 4-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)N(Cc2cccs2)C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C17H19NO5S2/c19-17(20)13-5-7-16(8-6-13)25(21,22)18(11-14-3-1-9-23-14)12-15-4-2-10-24-15/h2,4-8,10,14H,1,3,9,11-12H2,(H,19,20)/p-1/t14-/m1/s1 |
| InChIKey | BYSQXYQCIQKQSU-CQSZACIVSA-M |
| XLogP | 1.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |