C11H17NO3S2 — CID 60681211
N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)methanesulfonamide (PubChem CID 60681211) has the molecular formula C11H17NO3S2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)methanesulfonamide.
| Compound Name | N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 60681211 |
| Molecular Formula | C11H17NO3S2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C11H17NO3S2/c1-17(13,14)12(8-10-4-2-6-15-10)9-11-5-3-7-16-11/h3,5,7,10H,2,4,6,8-9H2,1H3 |
| InChIKey | MPBFEAQOKBOUEZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |