C19H19NO5S2 — CID 39982795
2-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-6-sulfonamide (PubChem CID 39982795) has the molecular formula C19H19NO5S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-6-sulfonamide.
| Compound Name | 2-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-6-sulfonamide |
|---|---|
| PubChem CID | 39982795 |
| Molecular Formula | C19H19NO5S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 2-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)N(Cc3cccs3)C[C@@H]3CCCO3)ccc2o1 |
| InChI | InChI=1S/C19H19NO5S2/c21-19-8-5-14-11-17(6-7-18(14)25-19)27(22,23)20(12-15-3-1-9-24-15)13-16-4-2-10-26-16/h2,4-8,10-11,15H,1,3,9,12-13H2/t15-/m0/s1 |
| InChIKey | WWWSHQALPWLBOT-HNNXBMFYSA-N |
| XLogP | 3.22 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|