C14H18ClN3O3S2 — CID 42955157
5-chloro-1-methyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)imidazole-4-sulfonamide (PubChem CID 42955157) has the molecular formula C14H18ClN3O3S2 and a molecular weight of 375.90 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)imidazole-4-sulfonamide.
| Compound Name | 5-chloro-1-methyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 42955157 |
| Molecular Formula | C14H18ClN3O3S2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 5-chloro-1-methyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)N(Cc2cccs2)CC2CCCO2)c1Cl |
| InChI | InChI=1S/C14H18ClN3O3S2/c1-17-10-16-14(13(17)15)23(19,20)18(8-11-4-2-6-21-11)9-12-5-3-7-22-12/h3,5,7,10-11H,2,4,6,8-9H2,1H3 |
| InChIKey | DUOBPUSKEPXYPI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |