C17H21NO5S3 — CID 39982805
3-methylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 39982805) has the molecular formula C17H21NO5S3 and a molecular weight of 415.56 g/mol. Its IUPAC name is 3-methylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-methylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 39982805 |
| Molecular Formula | C17H21NO5S3 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 3-methylsulfonyl-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N(Cc2cccs2)C[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C17H21NO5S3/c1-25(19,20)16-7-2-8-17(11-16)26(21,22)18(12-14-5-3-9-23-14)13-15-6-4-10-24-15/h2,4,6-8,10-11,14H,3,5,9,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | GXALCVDHVAXJQC-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |