C17H19NO5S2 — CID 1154153
4-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid (PubChem CID 1154153) has the molecular formula C17H19NO5S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid.
| Compound Name | 4-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 1154153 |
| Molecular Formula | C17H19NO5S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[[(2S)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(Cc2cccs2)C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C17H19NO5S2/c19-17(20)13-5-7-16(8-6-13)25(21,22)18(11-14-3-1-9-23-14)12-15-4-2-10-24-15/h2,4-8,10,14H,1,3,9,11-12H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | BYSQXYQCIQKQSU-AWEZNQCLSA-N |
| XLogP | 2.82 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |