C19H25NO5S — CID 1083177
4-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]benzoic acid (PubChem CID 1083177) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 1083177 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2R)-oxolan-2-yl]methyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N(C[C@H]2CC=CCC2)C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H25NO5S/c21-19(22)16-8-10-18(11-9-16)26(23,24)20(14-17-7-4-12-25-17)13-15-5-2-1-3-6-15/h1-2,8-11,15,17H,3-7,12-14H2,(H,21,22)/t15-,17+/m0/s1 |
| InChIKey | QSAIKWFLQNXUQZ-DOTOQJQBSA-N |
| XLogP | 2.91 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|