C14H17IN2O3S — CID 23735291
N-(2-cyanoethyl)-4-iodo-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 23735291) has the molecular formula C14H17IN2O3S and a molecular weight of 420.27 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-iodo-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | N-(2-cyanoethyl)-4-iodo-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23735291 |
| Molecular Formula | C14H17IN2O3S |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | N-(2-cyanoethyl)-4-iodo-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | N#CCCN(CC1CCCO1)S(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H17IN2O3S/c15-12-4-6-14(7-5-12)21(18,19)17(9-2-8-16)11-13-3-1-10-20-13/h4-7,13H,1-3,9-11H2 |
| InChIKey | GMWUFFKEGKDFSB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|