C18H19F2NO2S2 — CID 55520684
4-(difluoromethylsulfanyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 55520684) has the molecular formula C18H19F2NO2S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55520684 |
| Molecular Formula | C18H19F2NO2S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(SC(F)F)cc1)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C18H19F2NO2S2/c19-18(20)25-15-7-5-13(6-8-15)17(22)21(11-14-3-1-9-23-14)12-16-4-2-10-24-16/h2,4-8,10,14,18H,1,3,9,11-12H2 |
| InChIKey | DQXNGQJAKHNYQT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |