C20H22INO3 — CID 55967993
3-iodo-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 55967993) has the molecular formula C20H22INO3 and a molecular weight of 451.30 g/mol. Its IUPAC name is 3-iodo-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-iodo-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55967993 |
| Molecular Formula | C20H22INO3 |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 3-iodo-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1CN(CC1CCCO1)C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C20H22INO3/c1-24-19-10-3-2-6-16(19)13-22(14-18-9-5-11-25-18)20(23)15-7-4-8-17(21)12-15/h2-4,6-8,10,12,18H,5,9,11,13-14H2,1H3 |
| InChIKey | YYQPYFIWBDANCC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|