C27H30N2O6 — CID 55968894
N-[(2-methoxyphenyl)methyl]-1,3-dioxo-N,2-bis(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 55968894) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-1,3-dioxo-N,2-bis(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-1,3-dioxo-N,2-bis(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 55968894 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-1,3-dioxo-N,2-bis(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | COc1ccccc1CN(CC1CCCO1)C(=O)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C27H30N2O6/c1-33-24-9-3-2-6-19(24)15-28(16-20-7-4-12-34-20)25(30)18-10-11-22-23(14-18)27(32)29(26(22)31)17-21-8-5-13-35-21/h2-3,6,9-11,14,20-21H,4-5,7-8,12-13,15-17H2,1H3 |
| InChIKey | NOBSZSCUYUDTAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|