C24H23FN2O4 — CID 31443327
N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide (PubChem CID 31443327) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide.
| Compound Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 31443327 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-1,3-dioxo-2-[[(2R)-oxolan-2-yl]methyl]isoindole-5-carboxamide |
| SMILES | O=C1c2ccc(C(=O)N(Cc3ccccc3F)C3CC3)cc2C(=O)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C24H23FN2O4/c25-21-6-2-1-4-16(21)13-26(17-8-9-17)22(28)15-7-10-19-20(12-15)24(30)27(23(19)29)14-18-5-3-11-31-18/h1-2,4,6-7,10,12,17-18H,3,5,8-9,11,13-14H2/t18-/m1/s1 |
| InChIKey | IFPZDHRODGNOAL-GOSISDBHSA-N |
| XLogP | 3.41 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|