C22H25FN2O4S — CID 43045341
N-cyclopropyl-N-[(2-fluorophenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide (PubChem CID 43045341) has the molecular formula C22H25FN2O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-fluorophenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43045341 |
| Molecular Formula | C22H25FN2O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-3-(oxolan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(c1cccc(S(=O)(=O)NCC2CCCO2)c1)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C22H25FN2O4S/c23-21-9-2-1-5-17(21)15-25(18-10-11-18)22(26)16-6-3-8-20(13-16)30(27,28)24-14-19-7-4-12-29-19/h1-3,5-6,8-9,13,18-19,24H,4,7,10-12,14-15H2 |
| InChIKey | AWOXDQNJJFVZFS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |