C18H18FNO5S — CID 95551441
3-(2-fluorophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid (PubChem CID 95551441) has the molecular formula C18H18FNO5S and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid.
| Compound Name | 3-(2-fluorophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 95551441 |
| Molecular Formula | C18H18FNO5S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-(2-fluorophenyl)-5-[[(2R)-oxolan-2-yl]methylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccccc2F)cc(S(=O)(=O)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H18FNO5S/c19-17-6-2-1-5-16(17)12-8-13(18(21)22)10-15(9-12)26(23,24)20-11-14-4-3-7-25-14/h1-2,5-6,8-10,14,20H,3-4,7,11H2,(H,21,22)/t14-/m1/s1 |
| InChIKey | NOPMCMMNBITNNZ-CQSZACIVSA-N |
| XLogP | 2.65 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |