C27H29NO5S — CID 55763148
4-(benzenesulfonylmethyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 55763148) has the molecular formula C27H29NO5S and a molecular weight of 479.60 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-(benzenesulfonylmethyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55763148 |
| Molecular Formula | C27H29NO5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-N-[(2-methoxyphenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1CN(CC1CCCO1)C(=O)c1ccc(CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO5S/c1-32-26-12-6-5-8-23(26)18-28(19-24-9-7-17-33-24)27(29)22-15-13-21(14-16-22)20-34(30,31)25-10-3-2-4-11-25/h2-6,8,10-16,24H,7,9,17-20H2,1H3 |
| InChIKey | STZUXHBKKQZRDV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |